Inorganic Salts
Filtered Search Results
Cerium(III) chloride heptahydrate, 99%
CAS: 18618-55-8 Molecular Formula: CeCl3·7H2O MDL Number: MFCD00149634 Synonym: Cerous chloride heptahydrate
| CAS | 18618-55-8 |
|---|---|
| MDL Number | MFCD00149634 |
| Synonym | Cerous chloride heptahydrate |
| Molecular Formula | CeCl3·7H2O |
Lithium hydride, 99.4% (metals basis)
CAS: 7580-67-8 Molecular Formula: HLi Molecular Weight (g/mol): 7.948 MDL Number: MFCD00011074 InChI Key: SRTHRWZAMDZJOS-UHFFFAOYSA-N Synonym: lithium hydride,lithiumhydride,lih,lithium hydride anion,hydride lithium,hydridolithate 1-,lih-,ksc491a4n PubChem CID: 62714 IUPAC Name: lithium;hydride SMILES: [H-].[Li+]
| PubChem CID | 62714 |
|---|---|
| CAS | 7580-67-8 |
| Molecular Weight (g/mol) | 7.948 |
| MDL Number | MFCD00011074 |
| SMILES | [H-].[Li+] |
| Synonym | lithium hydride,lithiumhydride,lih,lithium hydride anion,hydride lithium,hydridolithate 1-,lih-,ksc491a4n |
| IUPAC Name | lithium;hydride |
| InChI Key | SRTHRWZAMDZJOS-UHFFFAOYSA-N |
| Molecular Formula | HLi |
Sodium nitrite, 99.999% (metals basis)
CAS: 7632-00-0 Molecular Formula: NNaO2 Molecular Weight (g/mol): 69.00 MDL Number: MFCD00011118 InChI Key: LPXPTNMVRIOKMN-UHFFFAOYSA-M Synonym: sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts PubChem CID: 23668193 ChEBI: CHEBI:78870 IUPAC Name: sodium;nitrite SMILES: [Na+].[O-]N=O
| PubChem CID | 23668193 |
|---|---|
| CAS | 7632-00-0 |
| Molecular Weight (g/mol) | 69.00 |
| ChEBI | CHEBI:78870 |
| MDL Number | MFCD00011118 |
| SMILES | [Na+].[O-]N=O |
| Synonym | sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts |
| IUPAC Name | sodium;nitrite |
| InChI Key | LPXPTNMVRIOKMN-UHFFFAOYSA-M |
| Molecular Formula | NNaO2 |
Tungsten(VI) oxide, 99.8% (metals basis)
CAS: 1314-35-8 Molecular Formula: O3W Molecular Weight (g/mol): 231.837 MDL Number: MFCD00011466 InChI Key: ZNOKGRXACCSDPY-UHFFFAOYSA-N Synonym: tungsten trioxide,tungsten vi oxide,tungstic oxide,tungstic anhydride,tungsten oxide wo3,tungsten blue,tungstic acid anhydride,wolframic acid, anhydride,tungstentrioxide,acmc-20ajaa PubChem CID: 14811 IUPAC Name: trioxotungsten SMILES: O=[W](=O)=O
| PubChem CID | 14811 |
|---|---|
| CAS | 1314-35-8 |
| Molecular Weight (g/mol) | 231.837 |
| MDL Number | MFCD00011466 |
| SMILES | O=[W](=O)=O |
| Synonym | tungsten trioxide,tungsten vi oxide,tungstic oxide,tungstic anhydride,tungsten oxide wo3,tungsten blue,tungstic acid anhydride,wolframic acid, anhydride,tungstentrioxide,acmc-20ajaa |
| IUPAC Name | trioxotungsten |
| InChI Key | ZNOKGRXACCSDPY-UHFFFAOYSA-N |
| Molecular Formula | O3W |
Titanium(IV) isopropoxide, 97+%
CAS: 546-68-9 Molecular Formula: C12H28O4Ti Molecular Weight (g/mol): 284.219 MDL Number: MFCD00008871 InChI Key: VXUYXOFXAQZZMF-UHFFFAOYSA-N Synonym: titanium tetraisopropanolate,titanium iv isopropoxide,tetraisopropyl orthotitanate,titanium isopropoxide,titanium tetraisopropylate,titanium isopropylate,ti isopropylate,tetraisopropoxytitanium iv,isopropyl orthotitanate,tetraisopropyl titanate PubChem CID: 11026 IUPAC Name: propan-2-olate;titanium(4+) SMILES: CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-].[Ti+4]
| PubChem CID | 11026 |
|---|---|
| CAS | 546-68-9 |
| Molecular Weight (g/mol) | 284.219 |
| MDL Number | MFCD00008871 |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-].[Ti+4] |
| Synonym | titanium tetraisopropanolate,titanium iv isopropoxide,tetraisopropyl orthotitanate,titanium isopropoxide,titanium tetraisopropylate,titanium isopropylate,ti isopropylate,tetraisopropoxytitanium iv,isopropyl orthotitanate,tetraisopropyl titanate |
| IUPAC Name | propan-2-olate;titanium(4+) |
| InChI Key | VXUYXOFXAQZZMF-UHFFFAOYSA-N |
| Molecular Formula | C12H28O4Ti |
Hydrogen bromide, pure, 33 wt% solution in glacial acetic acid
CAS: 10035-10-6 Molecular Formula: BrH Molecular Weight (g/mol): 80.91 MDL Number: MFCD00011323 InChI Key: CPELXLSAUQHCOX-UHFFFAOYSA-N Synonym: hydrogen bromide,hydrobromic acid,bromwasserstoff,broomwaterstof,bromowodor,acido bromidrico,acide bromhydrique,anhydrous hydrobromic acid,bromowodor polish,hydrobromide PubChem CID: 260 ChEBI: CHEBI:47266 SMILES: Br
| PubChem CID | 260 |
|---|---|
| CAS | 10035-10-6 |
| Molecular Weight (g/mol) | 80.91 |
| ChEBI | CHEBI:47266 |
| MDL Number | MFCD00011323 |
| SMILES | Br |
| Synonym | hydrogen bromide,hydrobromic acid,bromwasserstoff,broomwaterstof,bromowodor,acido bromidrico,acide bromhydrique,anhydrous hydrobromic acid,bromowodor polish,hydrobromide |
| InChI Key | CPELXLSAUQHCOX-UHFFFAOYSA-N |
| Molecular Formula | BrH |
Rubidium iodide, 99.8% (metals basis)
CAS: 7790-29-6 Molecular Formula: IRb Molecular Weight (g/mol): 212.372 MDL Number: MFCD00011192 InChI Key: WFUBYPSJBBQSOU-UHFFFAOYSA-M Synonym: rubidium iodide,rubidium-iodid,rubidium jodatum,unii-18cyw0vl2x,rubidium 1+ iodide,rubidium 1+ ion iodide,18cyw0vl2x,i.rb,acmc-20ajs7 PubChem CID: 3423208 IUPAC Name: rubidium(1+);iodide SMILES: [Rb+].[I-]
| PubChem CID | 3423208 |
|---|---|
| CAS | 7790-29-6 |
| Molecular Weight (g/mol) | 212.372 |
| MDL Number | MFCD00011192 |
| SMILES | [Rb+].[I-] |
| Synonym | rubidium iodide,rubidium-iodid,rubidium jodatum,unii-18cyw0vl2x,rubidium 1+ iodide,rubidium 1+ ion iodide,18cyw0vl2x,i.rb,acmc-20ajs7 |
| IUPAC Name | rubidium(1+);iodide |
| InChI Key | WFUBYPSJBBQSOU-UHFFFAOYSA-M |
| Molecular Formula | IRb |
Sodium chlorate, 99%, ACS reagent
CAS: 7775-09-9 Molecular Formula: ClNaO3 Molecular Weight (g/mol): 106.44 InChI Key: YZHUMGUJCQRKBT-UHFFFAOYSA-M Synonym: sodium chlorate,chloric acid, sodium salt,asex,chlorate de sodium,chlorsaure,tumbleleaf,atlacide,desolet,kusatol,rasikal PubChem CID: 516902 ChEBI: CHEBI:65242 SMILES: [Na+].[O-][Cl](=O)=O
| PubChem CID | 516902 |
|---|---|
| CAS | 7775-09-9 |
| Molecular Weight (g/mol) | 106.44 |
| ChEBI | CHEBI:65242 |
| SMILES | [Na+].[O-][Cl](=O)=O |
| Synonym | sodium chlorate,chloric acid, sodium salt,asex,chlorate de sodium,chlorsaure,tumbleleaf,atlacide,desolet,kusatol,rasikal |
| InChI Key | YZHUMGUJCQRKBT-UHFFFAOYSA-M |
| Molecular Formula | ClNaO3 |
Sodium phosphate, monobasic monohydrate, 99+%, for analysis
CAS: 10049-21-5 Molecular Formula: H5NaO5P Molecular Weight (g/mol): 139.00 MDL Number: MFCD00149208 InChI Key: BBMHARZCALWXSL-UHFFFAOYSA-N Synonym: sodium dihydrogen phosphate monohydrate,sodium phosphate monobasic monohydrate,monosodium phosphate monohydrate,unii-593yog76rn,phosphoric acid, monosodium salt, monohydrate,sodium phosphate monobasic hydrate,sodium dihydrogen phosphate hydrate,sodium dihydrogenphosphate monohydrate,sodium hydrate dihydrogen phosphate,pubchem12707 PubChem CID: 516949 SMILES: O.[Na+].OP(O)(O)=O
| PubChem CID | 516949 |
|---|---|
| CAS | 10049-21-5 |
| Molecular Weight (g/mol) | 139.00 |
| MDL Number | MFCD00149208 |
| SMILES | O.[Na+].OP(O)(O)=O |
| Synonym | sodium dihydrogen phosphate monohydrate,sodium phosphate monobasic monohydrate,monosodium phosphate monohydrate,unii-593yog76rn,phosphoric acid, monosodium salt, monohydrate,sodium phosphate monobasic hydrate,sodium dihydrogen phosphate hydrate,sodium dihydrogenphosphate monohydrate,sodium hydrate dihydrogen phosphate,pubchem12707 |
| InChI Key | BBMHARZCALWXSL-UHFFFAOYSA-N |
| Molecular Formula | H5NaO5P |
Potassium phosphate, monobasic, 99%, for analysis
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M Synonym: potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate PubChem CID: 516951 ChEBI: CHEBI:63036 IUPAC Name: potassium;dihydrogen phosphate SMILES: [K+].OP(O)([O-])=O
| PubChem CID | 516951 |
|---|---|
| CAS | 7778-77-0 |
| Molecular Weight (g/mol) | 136.08 |
| ChEBI | CHEBI:63036 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| Synonym | potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate |
| IUPAC Name | potassium;dihydrogen phosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |
Calcium sulfate, 99%, pure, anhydrous
CAS: 7778-18-9 Molecular Formula: CaO4S Molecular Weight (g/mol): 136.13 MDL Number: MFCD00010912 InChI Key: OSGAYBCDTDRGGQ-UHFFFAOYSA-L Synonym: calcium sulfate,drierite,gypsum,sulfuric acid, calcium salt 1:1,karstenite,calcium sulphate,anhydrous gypsum,plaster of paris,anhydrous calcium sulfate,calcium sulfate, anhydrous PubChem CID: 24497 ChEBI: CHEBI:31346 IUPAC Name: calcium;sulfate SMILES: [Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24497 |
|---|---|
| CAS | 7778-18-9 |
| Molecular Weight (g/mol) | 136.13 |
| ChEBI | CHEBI:31346 |
| MDL Number | MFCD00010912 |
| SMILES | [Ca++].[O-]S([O-])(=O)=O |
| Synonym | calcium sulfate,drierite,gypsum,sulfuric acid, calcium salt 1:1,karstenite,calcium sulphate,anhydrous gypsum,plaster of paris,anhydrous calcium sulfate,calcium sulfate, anhydrous |
| IUPAC Name | calcium;sulfate |
| InChI Key | OSGAYBCDTDRGGQ-UHFFFAOYSA-L |
| Molecular Formula | CaO4S |
Ammonium thiocyanate, ACS, 97.5% min
CAS: 1762-95-4 Molecular Formula: CH4N2S Molecular Weight (g/mol): 76.117 MDL Number: MFCD00011428 InChI Key: SOIFLUNRINLCBN-UHFFFAOYSA-N Synonym: ammonium thiocyanate,ammoniumrhodanid,thiocyanic acid, ammonium salt,ammonium isothiocyanate,ammonium rhodanate,weedazol tl,trans-aid,ammonium sulfocyanate,ammonium sulfocyanide,rhodanine, ammonium salt PubChem CID: 15666 IUPAC Name: azanium;thiocyanate SMILES: C(#N)[S-].[NH4+]
| PubChem CID | 15666 |
|---|---|
| CAS | 1762-95-4 |
| Molecular Weight (g/mol) | 76.117 |
| MDL Number | MFCD00011428 |
| SMILES | C(#N)[S-].[NH4+] |
| Synonym | ammonium thiocyanate,ammoniumrhodanid,thiocyanic acid, ammonium salt,ammonium isothiocyanate,ammonium rhodanate,weedazol tl,trans-aid,ammonium sulfocyanate,ammonium sulfocyanide,rhodanine, ammonium salt |
| IUPAC Name | azanium;thiocyanate |
| InChI Key | SOIFLUNRINLCBN-UHFFFAOYSA-N |
| Molecular Formula | CH4N2S |
Zinc iodide, 98+%, pure
CAS: 10139-47-6 Molecular Formula: I2Zn Molecular Weight (g/mol): 319.19 MDL Number: MFCD00011299
| CAS | 10139-47-6 |
|---|---|
| Molecular Weight (g/mol) | 319.19 |
| MDL Number | MFCD00011299 |
| Molecular Formula | I2Zn |
Tetrabutylammonium phosphate monobasic, 0.5M conc. in HPLC grade water, HPLC grade
CAS: 5574-97-0 | C16H38NO4P | 339.46 g/mol
| Boiling Point | 100.0°C |
|---|---|
| Linear Formula | (CH3(CH2)3)4NH2PO4 |
| Molecular Weight (g/mol) | 339.46 |
| Physical Form | Solution |
| Chemical Name or Material | Tetrabutylammonium phosphate monobasic |
| SMILES | OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI Key | ARRNBPCNZJXHRJ-UHFFFAOYSA-M |
| Density | 1.0100g/mL |
| PubChem CID | 2735142 |
| Concentration or Composition (by Analyte or Components) | 0.48 to 0.52M |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement: IF ON SKIN: Wash with plenty of soap and water. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00064526 |
| Health Hazard 2 | GHS H Statement: Causes skin irritation. Causes serious eye irritation. |
| Packaging | Glass Bottle |
| Synonym | tetrabutylammonium dihydrogen phosphate,tetrabutylammonium phosphate,tetrabutylammonium dihydrogenphosphate,1-butanaminium, n,n,n-tributyl-, phosphate 1:1,tetra-n-butylammonium phosphate,tetrabutylazanium dihydrogen phosphate,dihydrogen phosphate; tetrabutylazanium,dihydrogen phosphate; tetrabutylammonium,tetrabutyl ammonium dihydrogen phosphate,tetrabutylammonium ion dihydrogenphosphate ion |
| IUPAC Name | dihydrogen phosphate;tetrabutylazanium |
| Molecular Formula | C16H38NO4P |
| EINECS Number | 226-947-1 |
| Formula Weight | 339.45 |
| Specific Gravity | 1.01 |
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate, (EDTA), 99-101%, Ultrapure
CAS: 10378-23-1 Molecular Formula: C10H20N2Na4O10 Molecular Weight (g/mol): 420.233 MDL Number: MFCD00150026 InChI Key: DGWOWDJDIBPYOR-UHFFFAOYSA-N Synonym: ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate PubChem CID: 131843362 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate SMILES: C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na]
| PubChem CID | 131843362 |
|---|---|
| CAS | 10378-23-1 |
| Molecular Weight (g/mol) | 420.233 |
| MDL Number | MFCD00150026 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na] |
| Synonym | ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate |
| InChI Key | DGWOWDJDIBPYOR-UHFFFAOYSA-N |
| Molecular Formula | C10H20N2Na4O10 |